No products
View larger AOB1672884
CAS: 1672-88-4 (free base)
Chemical Name: 2,4-Imidazolidinedione, 1-((3-(5-nitro-2-furanyl)-2-propen-1-ylidene)amino)-
5000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $9.35 | Total: $46.75 |
| 1 | 10 | $7.92 | Total: $79.20 |
| 1 | 25 | $6.71 | Total: $167.75 |
| 1 | 50 | $5.72 | Total: $286.00 |
| 1 | 100 | $4.95 | Total: $495.00 |
| Molecular Formula | C10H8N4O5 |
| Molecular Weight | 264.197 |
| CAS Numbers | 1672-88-4 (free base) |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Akritoin, Furazidine; NF 416; NF-416; NF416; Furagin; Furazidin; |
| IUPAC/Chemical Name | 2,4-Imidazolidinedione, 1-((3-(5-nitro-2-furanyl)-2-propen-1-ylidene)amino)- |
| InChl Key | DECBQELQORZLLP-UAIOPKHMSA-N |
| InChl Code | InChI=1S/C10H8N4O5/c15-8-6-13(10(16)12-8)11-5-1-2-7-3-4-9(19-7)14(17)18/h1-5H,6H2,(H,12,15,16)/b2-1+,11-5+ |
| SMILES Code | O=C1NC(CN1/N=C/C=C/C2=CC=C([N+]([O-])=O)O2)=O |
| References | 1) Pustenko A, Nocentini A, Gratteri P, Bonardi A, Vozny I, Žalubovskis R, Supuran CT. The antibiotic furagin and its derivatives are isoform-selective human carbonic anhydrase inhibitors. J Enzyme Inhib Med Chem. 2020 Dec;35(1):1011-1020. doi: 10.1080/14756366.2020.1752201. PMID: 32297543; PMCID: PMC7178874. 2) Dybowski B, Jabłońska O, Radziszewski P, Gromadzka-Ostrowska J, Borkowski A. Ciprofloxacin and furagin in acute cystitis: comparison of early immune and microbiological results. Int J Antimicrob Agents. 2008 Feb;31(2):130-4. doi: 10.1016/j.ijantimicag.2007.08.021. Epub 2007 Dec 3. PMID: 18060746. |
An anti-infective agent