No products
View larger AOB3936
CAS: 221529-58-4
Chemical Name: RO1138452; N-[4-[(4-Propan-2-yloxyphenyl)methyl]phenyl]-4,5-dihydro-1H-imidazol-2-amine
O1138452; N-[4-[(4-Propan-2-yloxyphenyl)methyl]phenyl]-4,5-dihydro-1H-imidazol-
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $14.45 | Total: $72.25 |
| 1 | 10 | $12.24 | Total: $122.40 |
| 1 | 25 | $10.37 | Total: $259.25 |
| 1 | 50 | $8.84 | Total: $442.00 |
| 1 | 100 | $7.65 | Total: $765.00 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.4 |
| CAS Numbers | 221529-58-4 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | 4,5-dihydro-N-[4-[[4-(1-methylethoxy)phenyl]methyl]phenyl]-1H-imadazol-2-amine |
| InChl Key | GYYRMJMXXLJZAB-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C19H23N3O/c1-14(2)23-18-9-5-16(6-10-18)13-15-3-7-17(8-4-15)22-19-20-11-12-21-19/h3-10,14H,11-13H2,1-2H3,(H2,20,21,22) |
| SMILES Code | CC(C)Oc1ccc(cc1)Cc1ccc(cc1)NC1=NCCN1 |
| References | Clark, R.D., Jahangir, A., Severance, D., et al. Discovery and SAR development of 2-(phenylamino) imidazolines as prostacyclin receptor antagonists. Bioorganic & Medicinal Chemistry Letters 14, 1053-1056 (2004). |
Potent and selective IP (prostacyclin) receptor antagonist