No products
View larger AOB13921
CAS:N/A
Chemical Name: EVP-22; 5-(2,6-Dichlorophenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene
994 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.16 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | ML2-SA1 |
| IUPAC/Chemical Name | 5-(2,6-Dichlorophenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene |
| InChl Key | NBXVMFMMTKYFQP-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C14H13Cl2NO/c15-9-2-1-3-10(16)12(9)13-11-7-4-5-8(6-7)14(11)18-17-13/h1-3,7-8,11,14H,4-6H2 |
| SMILES Code | ClC1=C(C2=NOC3C(C4)CCC4C23)C(Cl)=CC=C1 |
| References | 1) E Plesch et al. Selective agonist of TRPML2 reveals direct role in chemokine release from innate immune cells. Elife. 2018 Nov 27;7. pii: e39720. |
Novel selective agonist of TRPML2, revealing direct role in chemokine release from innate immune cells, promoting macrophage migration