No products
View larger AOB6575
CAS: 131631-89-5
Chemical Name: N-[3-[4-[[4-(3,4-Dihydro-2-oxo-1(2H)quinolinyl)-1-piperidinyl]carbonyl]phenoxy]propyl]-acetamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 |
| CAS Numbers | 131631-89-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO and Alcohol |
| Purity | 98% by HPLC |
| Synonym | OPC-21268; OPC21268; OPC 21268 |
| IUPAC/Chemical Name | N-(3-(4-(4-(2-oxo-3,4-dihydroquinolin-1(2H)-yl)piperidine-1-carbonyl)phenoxy)propyl)acetamide |
| InChl Key | KSNUCNRMDYJBKT-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C26H31N3O4/c1-19(30)27-15-4-18-33-23-10-7-21(8-11-23)26(32)28-16-13-22(14-17-28)29-24-6-3-2-5-20(24)9-12-25(29)31/h2-3,5-8,10-11,22H,4,9,12-18H2,1H3,(H,27,30) |
| SMILES Code | CC(NCCCOC1=CC=C(C(N2CCC(N3C(CCC4=C3C=CC=C4)=O)CC2)=O)C=C1)=O |
| References | 1) Shinoura H, Take H, Itoh S, Hirasawa A, Inoue K, Ohno Y, Hashimoto K, Tsujimoto G. Key amino acids of vasopressin V1a receptor responsible for the species difference in the affinity of OPC-21268. FEBS Lett. 2000 Jan 28;466(2-3):255-8. Erratum in: FEBS Lett 2000 Jun 2;474(2-3):257. PubMed PMID: 10682838. 2) Sugimoto I, Narimiya N, Odagiri M, Ohnishi A, Tanaka T. Protective effect of a vasopressin-1 selective antagonist, OPC-21268, against ethanol-induced damage of the rat gastric wall. Dig Dis Sci. 1999 Mar;44(3):503-9. PubMed PMID: 10080141. |
Nonpeptide vasopressin V1 receptor antagonist