No products
View larger AOB1237
CAS: 191868-14-1
Chemical Name: LS-28466;(2R)-N-[[4-[(carbamoylamino)methyl]phenyl]methyl]-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]pentanamide trifluoroacetate
5800 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C33H37F6N7O7 |
| Molecular Weight | 757.69 |
| CAS Numbers | 191868-14-1 (TFA) |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | BIBO-3304; BIBO 3304; BIBO3304; BIBO-3304 TFA |
| IUPAC/Chemical Name | (R)-2-(2,2-diphenylacetamido)-5-guanidino-N-(4-(ureidomethyl)benzyl)pentanamide bis(2,2,2-trifluoroacetate) |
| InChl Key | XWZMETGYCRXJJH-PPLJNSMQSA-N |
| InChl Code | InChI=1S/C29H35N7O3.2C2HF3O2/c30-28(31)33-17-7-12-24(26(37)34-18-20-13-15-21(16-14-20)19-35-29(32)39)36-27(38)25(22-8-3-1-4-9-22)23-10-5-2-6-11-23;2*3-2(4,5)1(6)7/h1-6,8-11,13-16,24-25H,7,12,17-19H2,(H,34,37)(H,36,38)(H4,30,31,33)(H3,32,35,39);2*(H,6,7)/t24-;;/m1../s1 |
| SMILES Code | O=C(N[C@@H](C(NCC1=CC=C(CNC(N)=O)C=C1)=O)CCCNC(N)=N)C(C2=CC=CC=C2)C3=CC=CC=C3.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| References | 1) Shi Z, Li B, Brooks VL. Role of the Paraventricular Nucleus of the Hypothalamus in the Sympathoexcitatory Effects of Leptin. Hypertension. 2015 Nov;66(5):1034-41. doi: 10.1161/HYPERTENSIONAHA.115.06017. Epub 2015 Sep 14. PubMed PMID: 26370892; PubMed Central PMCID: PMC4798233. 2) Wierońska JM, Smiałowska M, Brański P, Gasparini F, Kłodzińska A, Szewczyk B, Pałucha A, Chojnacka-Wójcik E, Pilc A. In the amygdala anxiolytic action of mGlu5 receptors antagonist MPEP involves neuropeptide Y but not GABAA signaling. Neuropsychopharmacology. 2004 Mar;29(3):514-21. PubMed PMID: 14666119. |
Potent NPY Y1 receptor antagonist