No products
View larger AOB17058
CAS: 56943-06-7
Chemical Name: (-)-4-Bromolevamisole; (S)-6-(4-Bromophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole
100 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $58.65 | Total: $293.25 |
| 1 | 10 | $49.68 | Total: $496.80 |
| 1 | 25 | $42.09 | Total: $1,052.25 |
| 1 | 50 | $35.88 | Total: $1,794.00 |
| 1 | 100 | $31.05 | Total: $3,105.00 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 |
| CAS Numbers | 56943-06-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | (-)-4-Bromolevamisole; T1001; T 1001; T-1001IUPAC/Chemical Name:InChi Key:InChi Code:SMILES Code: |
| IUPAC/Chemical Name | (S)-6-(4-Bromophenyl)-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole |
| InChl Key | HTHGAIADRJRJOY-SNVBAGLBSA-N |
| InChl Code | InChI=1S/C11H11BrN2S/c12-9-3-1-8(2-4-9)10-7-14-5-6-15-11(14)13-10/h1-4,10H,5-7H2/t10-/m1/s1 |
| SMILES Code | BrC1=CC=C([C@@H]2N=C3SCCN3C2)C=C1 |
Novel antagonist of hypoxia-inducible factor-2α subunit (HIF-2α), displacing residue M252 from inside the HIF-2α PAS-B pocket toward the ARNT subunit to weaken heterodimerization