No products
View larger ATP1889
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $141.95 | Total: $709.75 |
| 1 | 10 | $120.24 | Total: $1,202.40 |
| 1 | 25 | $101.87 | Total: $2,546.75 |
| 1 | 50 | $86.84 | Total: $4,342.00 |
| 1 | 100 | $75.15 | Total: $7,515.00 |
| Molecular Formula | C34H39N7O4 |
| Molecular Weight | 609.72 |
| CAS Numbers | 475498-26-1 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C([C@H](C(N[C@H](C(N[C@@H](CC1=CC2=C(C=C1)C=CC=C2)C(N)=O)=O)CCCNC(=N)N)=O)NC(C)=O)C3=CC4=C(C=C3)C=CC=C4 |
| References | Chaki et al [2003] Involvement of the melanocortin MC4 receptor in stress-related behavior in rodents. Eur.J.Pharmacol. 474 95 PMID |