No products
View larger | Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $127.50 | Total: $637.50 |
| 1 | 10 | $108.00 | Total: $1,080.00 |
| 1 | 25 | $91.50 | Total: $2,287.50 |
| 1 | 50 | $78.00 | Total: $3,900.00 |
| 1 | 100 | $67.50 | Total: $6,750.00 |
| Molecular Formula | C53H73N13O11 |
| Molecular Weight | 1068.23 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CCCCC(NC(C)=O)C(N[C@H]1CC(NCCCC[C@@H](C(N)=O)NC([C@H](CC2=CNC3=CC=CC=C32)NC([C@H](CCCN=C(N)N)NC([C@@H](CC4=CC5=CC=CC=C5C=C4)NC(CCNC1=O)=O)=O)=O)=O)=O)=O.CC(O)=O |
| References | Paolo Grieco, et al. Further structure-activity studies of lactam derivatives of MT-II and SHU-9119 their activity and selectivity at human melanocortin receptors 3, 4, and 5. Peptides |