No products
View larger ATP2212L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $32.30 | Total: $161.50 |
| 1 | 10 | $27.36 | Total: $273.60 |
| 1 | 25 | $23.18 | Total: $579.50 |
| 1 | 50 | $19.76 | Total: $988.00 |
| 1 | 100 | $17.10 | Total: $1,710.00 |
| Molecular Formula | C79H113N21O21S |
| Molecular Weight | 1724.94 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CSCC[C@@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N1CCC[C@H]1C(N[C@H](C(N)=O)C(C)C)=O)=O)CCCCN)=O)=O)CC2=CNC3=C2C=CC=C3)=O)CCCNC(N)=N)=O)CC4=CC=CC=C4)=O)CC5=CNC=N5)=O)CCC(O)=O)=O)NC([C@@H](NC([C@@H](NC([C@@H](NC(C)=O)CO)=O)CC6=CC=C(C=C6)O)=O)CO)=O.CC(O)=O |
| References | Daw et al [2000] PDZ proteins interacting with C-terminal GluR23 are involved in a PKC-dependent regulation of AMPA receptors at hippocampal synapses. Neuron 28 873 PMID 11163273 |