No products
View larger ATP1039
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $127.50 | Total: $637.50 |
| 1 | 10 | $108.00 | Total: $1,080.00 |
| 1 | 25 | $91.50 | Total: $2,287.50 |
| 1 | 50 | $78.00 | Total: $3,900.00 |
| 1 | 100 | $67.50 | Total: $6,750.00 |
| Molecular Formula | C129H216N42O42 |
| Molecular Weight | 3027.35 |
| CAS Numbers | 121028-49-7 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | [C@H](CC1=CC=CC=C1)(C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@H](C(N[C@@H](C(C)C)C(N)=O)=O)CC(C)C)=O)=O)CCC(N)=O)=O)CC(C)C)=O)CC(C)C)=O)CCCNC(=N)N)=O)CCC(N)=O)=O)CC(C)C)=O)CCCNC(=N)N)=O)C)=O)CO)=O)CC(O)=O)=O)CCC(N)=O)=O)CC(C)C)=O)CCCNC(=N)N)=O)CO)=O)CC(C)C)=O)CCC(O)=O)=O)CO)=O)[C@@H](C)O)=O)NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@H](CC2=CN=CN2)N)=O)CO)=O)CC(O)=O)=O)=O)[C@@H](C)O)=O |
| References | Nussdorfer GG, et al. Secretin, glucagon, gastric inhibitory polypeptide, parathyroid hormone, and related peptides in the regulation of the hypothalamus- pituitary-adrenal axis. Peptides. 2000 Feb;21[2] 309-24. |