No products
View larger ATQ0255
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $29.75 | Total: $148.75 |
| 1 | 10 | $25.20 | Total: $252.00 |
| 1 | 25 | $21.35 | Total: $533.75 |
| 1 | 50 | $18.20 | Total: $910.00 |
| 1 | 100 | $15.75 | Total: $1,575.00 |
| Molecular Formula | C29H28F2N6O2 |
| Molecular Weight | 530.57 |
| CAS Numbers | 1660963-42-7 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F |
| References | Xiangping Qian, et al. Abstract 2078 CK-101 [RX518], a mutant-selective inhibitor of EGFR that overcomes T790M-mediated resistance in NSCLC. |