No products
View larger AOB1356
CAS No: 1883548-87-5
Chemical Name: CID-45100448; 3-Cyclohexyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidine-2,4-dione
500 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $11.05 | Total: $55.25 |
| 1 | 10 | $9.36 | Total: $93.60 |
| 1 | 25 | $7.93 | Total: $198.25 |
| 1 | 50 | $6.76 | Total: $338.00 |
| 1 | 100 | $5.85 | Total: $585.00 |
| Molecular Formula | C21H25F3N4O2 |
| Molecular Weight | 422.44 |
| CAS Numbers | 1883548-87-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | SR03-1309, CID-45100448 |
| IUPAC/Chemical Name | 3-cyclohexyl-6-[4-[3-(trifluoromethyl)phenyl]-1-piperazinyl]-2,4(1H,3H)-pyrimidinedione |
| InChl Key | MFABFKUNLDYKGH-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C21H25F3N4O2/c22-21(23,24)15-5-4-8-17(13-15)26-9-11-27(12-10-26)18-14-19(29)28(20(30)25-18)16-6-2-1-3-7-16/h4-5,8,13-14,16H,1-3,6-7,9-12H2,(H,25,30) |
| SMILES Code | O=C(N1)N(C2CCCCC2)C(C=C1N(CC3)CCN3C4=CC=CC(C(F)(F)F)=C4)=O |
| References | Busby, S., Nuhant, P., Cameron, M., et al. Discovery of inverse agonists for the liver receptor homologue-1 (LRH1; NR5A2). 1-55 (2010). |
Inverse Agonist for LRH1 (NR5A2)