No products
View larger AOB31163
CAS No: 10447-39-9
Chemical Name: 1-Azabicyclo[2.2.2]octan-3-yl(diphenyl)methanol
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $36.55 | Total: $182.75 |
| 1 | 10 | $30.96 | Total: $309.60 |
| 1 | 25 | $26.23 | Total: $655.75 |
| 1 | 50 | $22.36 | Total: $1,118.00 |
| 1 | 100 | $19.35 | Total: $1,935.00 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 |
| CAS Numbers | 10447-39-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Phencarol; Fenatin; Fencarol; Quifenadine |
| IUPAC/Chemical Name | 1-Azabicyclo[2.2.2]octan-3-yl(diphenyl)methanol |
| InChl Key | PZMAHNDJABQWGS-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C20H23NO/c22-20(17-7-3-1-4-8-17,18-9-5-2-6-10-18)19-15-21-13-11-16(19)12-14-21/h1-10,16,19,22H,11-15H2 |
| SMILES Code | OC(C1=CC=CC=C1)(C2CN3CCC2CC3)C4=CC=CC=C4 |
| References | 1) Luss LV. [Use of antihistamines in a physician's clinical practice]. Ter Arkh. 2014;86(8):106-9. Review. Russian. PubMed PMID: 25306755. 2) Makarov L, Balykova L, Soldatova O, Komolyatova V, Serebruany V. The antiarrhythmic properties of quifenadine, H1-histamine receptor blocker in children with premature beats: a randomized controlled pilot trial. Am J Ther. 2010 Jul-Aug;17(4):396-401. |
| PubChem ID | 22029352 |
H1-histamine receptor blocker, antiarrhythmic