No products
View larger AT9770
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $81.60 | Total: $408.00 |
| 1 | 10 | $69.12 | Total: $691.20 |
| 1 | 25 | $58.56 | Total: $1,464.00 |
| 1 | 50 | $49.92 | Total: $2,496.00 |
| 1 | 100 | $43.20 | Total: $4,320.00 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.49 |
| CAS Numbers | 1394808-82-2 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O(C1CCN(CC1)C2CCC2)C3=CC=C(NC(CN4CCOCC4)=O)C=C3 |
| References | Nirogi R, et al. Samelisant [SUVN-G3031], a potent, selective and orally active histamine H3 receptor inverse agonist for the potential treatment of narcolepsy pharmacological and neurochemical characterisation. Psychopharmacology [Berl]. 2021 Jun;238[6] 1495-1511. |