No products
View larger AT10678
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $34.85 | Total: $174.25 |
| 1 | 10 | $29.52 | Total: $295.20 |
| 1 | 25 | $25.01 | Total: $625.25 |
| 1 | 50 | $21.32 | Total: $1,066.00 |
| 1 | 100 | $18.45 | Total: $1,845.00 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 |
| CAS Numbers | 192203-60-4 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | COc1ccc(SC(=O)N[C@@H](CCC(O)=O)C(O)=O)cc1 |
| References | Khan, Tariq H.; Eno-Amooquaye, Ebun A.; Searle, Frances et al. Novel Inhibitors of Carboxypeptidase G2 [CPG2] Potential Use in Antibody-Directed Enzyme Prodrug Therapy. Journal of Medicinal Chemistry [1999], 42[6], 951-956. |