No products
View larger AT21506
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $22.10 | Total: $110.50 |
| 1 | 10 | $18.72 | Total: $187.20 |
| 1 | 25 | $15.86 | Total: $396.50 |
| 1 | 50 | $13.52 | Total: $676.00 |
| 1 | 100 | $11.70 | Total: $1,170.00 |
| Molecular Formula | C25H22ClF3N6O3 |
| Molecular Weight | 546.93 |
| CAS Numbers | 1033805-28-5 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | Cc1ccn(n1)-c1cc(Cl)ccc1[C@@H](Oc1cc(nc(N)n1)-c1ccc(C[C@H](N)C(O)=O)cc1)C(F)(F)F |
| References | Lapuerta P, et al. Telotristat etiprate, a novel inhibitor of serotonin synthesis for the treatment of carcinoid syndrome. Clin. Invest. [Lond.] [2015] 5[5], 447 |