No products
View larger AOB12978
CAS 1309784-09-5
Chemical Name: JTE051; (2S)-N-[2-(6,6-Dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-1H-indol-6-yl]-N-methyl-2-morpholin-4-ylpropanamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.88 | Total: $159.38 |
| 1 | 10 | $27.00 | Total: $270.00 |
| 1 | 25 | $22.88 | Total: $571.88 |
| 1 | 50 | $19.50 | Total: $975.00 |
| 1 | 100 | $16.88 | Total: $1,687.50 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 |
| CAS Numbers | 1309784-09-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | JTE-051; JTE051; JTE 051 |
| IUPAC/Chemical Name | (S)-N-(2-(6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazol-3-yl)-1H-indol-6-yl)-N-methyl-2-morpholinopropanamide |
| InChl Key | ZZZXGCPVQQOASC-INIZCTEOSA-N |
| InChl Code | InChI=1S/C25H33N5O2/c1-16(30-9-11-32-12-10-30)24(31)29(4)18-6-5-17-13-21(26-20(17)14-18)23-19-7-8-25(2,3)15-22(19)27-28-23/h5-6,13-14,16,26H,7-12,15H2,1-4H3,(H,27,28)/t16-/m0/s1 |
| SMILES Code | C[C@H](N1CCOCC1)C(N(C2=CC3=C(C=C2)C=C(C4=NNC5=C4CCC(C)(C)C5)N3)C)=O |
| References | 1) Julien Blaess et al., Immunosuppressive agents for rheumatoid arthritis: a systematic review of clinical trials and their current development stage, Sage Journal 3:625 (2020) |
Novel inhibitor of interleukin-2-inducible T cell kinase (ITK), suppressing the signal to activate T cells related to immune response