No products
View larger AT6812L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $34.00 | Total: $170.00 |
| 1 | 10 | $28.80 | Total: $288.00 |
| 1 | 25 | $24.40 | Total: $610.00 |
| 1 | 50 | $20.80 | Total: $1,040.00 |
| 1 | 100 | $18.00 | Total: $1,800.00 |
| Molecular Formula | C29H42F3N9O9 |
| Molecular Weight | 717.69 |
| CAS Numbers | 500577-51-5 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | OC(=O)C(F)(F)F.NCCCC[C@@H]1NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CC(O)=O)NC(=O)CNC(=O)[C@H](CCCNC(N)=N)NC1=O |
| References | Lopez-Rodriguez V, et al. Preparation and preclinical evaluation of [66]Ga-DOTA-E[c[RGDfK]]2 as a potential theranostic radiopharmaceutical. Nucl Med Biol. 2015 Feb;42[2] 109-14. |