No products
View larger AOB1132
CAS: 199986-75-9
Chemical Name: 2-[2-Hydroxyethyl-[6-[(4-methoxyphenyl)methylamino]-9-propan-2-ylpurin-2-yl]amino]ethanol
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.5 |
| CAS Numbers | 199986-75-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 95% by HPLC |
| Synonym | CVT 313; CVT313 |
| IUPAC/Chemical Name | 2,2'-[[6-[[(4-methoxyphenyl)methyl]amino]-9-(1-methylethyl)-9H-purin-2-yl]imino]bis-ethanol |
| InChl Key | NQVIIUBWMBHLOZ-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C20H28N6O3/c1-14(2)26-13-22-17-18(21-12-15-4-6-16(29-3)7-5-15)23-20(24-19(17)26)25(8-10-27)9-11-28/h4-7,13-14,27-28H,8-12H2,1-3H3,(H,21,23,24) |
| SMILES Code | OCCN(CCO)C1=NC(N(C(C)C)C=N2)=C2C(NCC3=CC=C(OC)C=C3)=N1 |
| References | 1) Brooks, E.E., Gray, N.S., Joly, A.H., et al. CVT-313, a specific and potent inhibitor of CDK2 that prevents neointimal proliferation. J. Biol. Chem. 272(46), 29207-29211 (1997). 2) Bhattacharjee, R.N., Banks, G.C., Trotter, K.W., et al. Histone H1 phosphorylation by Cdk2 selectively modulates mouse mammary tumor virus transcription through chromatin remodeling. Mol. Cell. Biol. 21(16), 5417-5454 (2001). |
Specific inhibitor of CDK2/cyclin A and CDK2/cyclin E