No products
View larger AOB87674
CAS: 1365267-27-1
Chemical Name: Ensartinib; (R)-6-Amino-5-(1-(2,6-dichloro-3-fluorophenyl)ethoxy)-N-(4-(4-methylpiperazine-1-carbonyl)phenyl)pyridazine-3-carboxamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $21.25 | Total: $106.25 |
| 1 | 10 | $18.00 | Total: $180.00 |
| 1 | 25 | $15.25 | Total: $381.25 |
| 1 | 50 | $13.00 | Total: $650.00 |
| 1 | 100 | $11.25 | Total: $1,125.00 |
| Molecular Formula | C25H25Cl2FN6O3 |
| Molecular Weight | 547.41 |
| CAS Numbers | 1370651-20-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | X-376; X 376; X376; Ensartinib-analog; X 396-analog; X396-analog; X-396-analog; |
| IUPAC/Chemical Name | 6-Amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-[4-[(4-methyl-1-piperazinyl)carbonyl]phenyl]-3-pyridazinecarboxamide |
| InChl Key | ONPGOSVDVDPBCY-CQSZACIVSA-N |
| InChl Code | InChI=1S/C25H25Cl2FN6O3/c1-14(21-17(26)7-8-18(28)22(21)27)37-20-13-19(31-32-23(20)29)24(35)30-16-5-3-15(4-6-16)25(36)34-11-9-33(2)10-12-34/h3-8,13-14H,9-12H2,1-2H3,(H2,29,32)(H,30,35)/t14-/m1/s1 |
| SMILES Code | O=C(C1=NN=C(N)C(O[C@@H](C2=C(Cl)C=CC(F)=C2Cl)C)=C1)NC3=CC=C(C(N4CCN(C)CC4)=O)C=C3 |
| References | 1) Sullivan I, Planchard D. ALK inhibitors in non-small cell lung cancer: the latest evidence and developments. Ther Adv Med Oncol. 2016 Jan;8(1):32-47. doi: 10.1177/1758834015617355. Review. PubMed PMID: 26753004; PubMed Central PMCID: PMC4699265. 2) Qiu W, Yuchi M, Ding M, Tessier D, Fenster A. Needle segmentation using 3D Hough transform in 3D TRUS guided prostate transperineal therapy. Med Phys. 2013 Apr;40(4):042902. doi: 10.1118/1.4795337. PubMed PMID: 23556924. |
Novel potent and highly specific ALK tyrosine kinase inhibitor (TKI)