No products
View larger AOB8576
CAS: 1792180-81-4
Chemical Name: 1-[(2S,5R)-2-Methyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-piperidin-1-yl]-propenone
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $21.25 | Total: $106.25 |
| 1 | 10 | $18.00 | Total: $180.00 |
| 1 | 25 | $15.25 | Total: $381.25 |
| 1 | 50 | $13.00 | Total: $650.00 |
| 1 | 100 | $11.25 | Total: $1,125.00 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 |
| CAS Numbers | 1792180-81-4 (free base) |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 99% (HPLC) |
| Synonym | PF-06651600 free base; PF-06651600; PF 06651600; PF06651600 |
| IUPAC/Chemical Name | 1-[(2S,5R)-2-Methyl-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-1-piperidinyl]-2-propen-1-one |
| InChl Key | CBRJPFGIXUFMTM-WDEREUQCSA-N |
| InChl Code | InChI=1S/C15H19N5O/c1-3-13(21)20-8-11(5-4-10(20)2)19-15-12-6-7-16-14(12)17-9-18-15/h3,6-7,9-11H,1,4-5,8H2,2H3,(H2,16,17,18,19)/t10-,11+/m0/s1 |
| SMILES Code | C=CC(N1[C@@H](C)CC[C@@H](NC2=C3C(NC=C3)=NC=N2)C1)=O |
Npvel potent JAK3-selective inhibitor, selectively targeting garmma-c cytokine pathways while preserving JAK1-dependent anti-inflammatory signaling such as the IL-10 suppressive functions following LPS treatment in macrophages and the suppression of TNFa and IL-1ß production in IL-27-primed macrophages