No products
View larger AOB87791
CAS: 955977-50-1
Chemical Name: 6-(4-Cyclopropylmethyl-piperazin-1-ylmethyl)-2-(5-fluoro-1H-indol-4-yl)-4-morpholin-4-yl-thieno[3,2-d]pyrimidine
500 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $21.25 | Total: $106.25 |
| 1 | 10 | $18.00 | Total: $180.00 |
| 1 | 25 | $15.25 | Total: $381.25 |
| 1 | 50 | $13.00 | Total: $650.00 |
| 1 | 100 | $11.25 | Total: $1,125.00 |
| Molecular Formula | C27H31FN6OS |
| Molecular Weight | 506.64 |
| CAS Numbers | 955977-50-1 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | PI-3065; PI3065; PI 3065. |
| IUPAC/Chemical Name | 6-[[4-(Cyclopropylmethyl)-1-piperazinyl]methyl]-2-(5-fluoro-1H-indol-4-yl)-4-(4-morpholinyl)-thieno[3,2-d]pyrimidine |
| InChl Key | YDNOHCOYQVZOMC-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C27H31FN6OS/c28-21-3-4-22-20(5-6-29-22)24(21)26-30-23-15-19(17-33-9-7-32(8-10-33)16-18-1-2-18)36-25(23)27(31-26)34-11-13-35-14-12-34/h3-6,15,18,29H,1-2,7-14,16-17H2 |
| SMILES Code | FC1=C(C2=NC(N3CCOCC3)=C4C(C=C(CN5CCN(CC6CC6)CC5)S4)=N2)C7=C(NC=C7)C=C1 |
| References | 1) Ali K, et al. Inactivation of PI(3)K p110δ breaks regulatory T-cell-mediated immune tolerance to cancer. Nature. 2014 Jun 19;510(7505):407-11. doi: 10.1038/nature13444. Epub2014 Jun 11. PubMed PMID: 24919154; PubMed Central PMCID: PMC4501086. |
A novel potent and selective PI3K p110δ inhibitor