No products
View larger AOB5921
CAS: 1092578-47-6
Chemical Name: 3-[(3S,4S)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanenitrile
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $33.15 | Total: $165.75 |
| 1 | 10 | $28.08 | Total: $280.80 |
| 1 | 25 | $23.79 | Total: $594.75 |
| 1 | 50 | $20.28 | Total: $1,014.00 |
| 1 | 100 | $17.55 | Total: $1,755.00 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.37 |
| CAS Numbers | 1092578-47-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Tofacitinib, R8081 |
| IUPAC/Chemical Name | 3-[(3S,4S)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]-3-oxopropanenitrile |
| SMILES Code | CN(C1=NC=NC2=C1C=CN2)[C@H]3[C@@H](C)CCN(C(CC#N)=O)C3 |
Inhibitor of Janus kinases, less active enantiomer of tofacitinib