No products
View larger AOB33606
CAS: 1874276-76-2
Chemical Name: Darovasertib; LXS196; IDE196; 3-Amino-N-[3-(4-amino-4-methylpiperidin-1-yl)pyridin-2-yl]-6-[3-(trifluoromethyl)pyridin-2-yl]pyrazine-2-carboxamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $31.45 | Total: $157.25 |
| 1 | 10 | $26.64 | Total: $266.40 |
| 1 | 25 | $22.57 | Total: $564.25 |
| 1 | 50 | $19.24 | Total: $962.00 |
| 1 | 100 | $16.65 | Total: $1,665.00 |
| Molecular Formula | C22H23F3N8O |
| Molecular Weight | 472.48 |
| CAS Numbers | 1874276-76-2 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | NVP-LXS196; NVPLXS196; NVP LXS196; LXS-196; LXS 196; LXS196; LXS-196 free base |
| IUPAC/Chemical Name | 3-amino-N-(3-(4-amino-4-methylpiperidin-1-yl)pyridin-2-yl)-6-(3-(trifluoromethyl)pyridin-2-yl)pyrazine-2-carboxamide |
| InChl Key | XXJXHXJWQSCNPX-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C22H23F3N8O/c1-21(27)6-10-33(11-7-21)15-5-3-9-29-19(15)32-20(34)17-18(26)30-12-14(31-17)16-13(22(23,24)25)4-2-8-28-16/h2-5,8-9,12H,6-7,10-11,27H2,1H3,(H2,26,30)(H,29,32,34) |
| SMILES Code | NC1=C(C(NC2=C(N3CCC(C)(N)CC3)C=CC=N2)=O)N=C(C4=NC=CC=C4C(F)(F)F)C=N1 |
| References | 1) Shaheer Khan et al., Novel Approaches to the Systemic Management of Uveal Melanoma, Current Oncology Reports volume 22, Article number: 104 (2020) |
Novel orally available protein kinase C (PKC) inhibitor, preventing the activation of PKC-mediated signaling pathways