No products
View larger AOB11511
CAS: 2138473-38-6
Chemical Name: (2S,3S)-N5-((1R,5S,6r)-3-oxabicyclo[3.1.0]hexan-6-yl)-2-(fluoromethyl)-N7-methyl-3-phenyl-2,3-dihydrobenzofuran-5,7-dicarboxamide
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $50.15 | Total: $250.75 |
| 1 | 10 | $42.48 | Total: $424.80 |
| 1 | 25 | $35.99 | Total: $899.75 |
| 1 | 50 | $30.68 | Total: $1,534.00 |
| 1 | 100 | $26.55 | Total: $2,655.00 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 |
| CAS Numbers | 2138473-38-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | GSK973; GSK 973; GSK-973 |
| IUPAC/Chemical Name | (2S,3S)-N5-((1R,5S,6r)-3-oxabicyclo[3.1.0]hexan-6-yl)-2-(fluoromethyl)-N7-methyl-3-phenyl-2,3-dihydrobenzofuran-5,7-dicarboxamide |
| InChl Key | WZQLVEPIBAOOGF-RMMWZPCPSA-N |
| InChl Code | InChI=1S/C23H23FN2O4/c1-25-23(28)15-8-13(22(27)26-20-16-10-29-11-17(16)20)7-14-19(12-5-3-2-4-6-12)18(9-24)30-21(14)15/h2-8,16-20H,9-11H2,1H3,(H,25,28)(H,26,27)/t16-,17+,18-,19+,20+/m1/s1 |
| SMILES Code | O=C(C1=CC(C(NC)=O)=C(O[C@H](CF)[C@H]2C3=CC=CC=C3)C2=C1)N[C@@H]4[C@@]5([H])COC[C@@]45[H] |
| References | 1) Alex Presto et al., GSK973 Is an Inhibitor of the Second Bromodomains (BD2s) of the Bromodomain and Extra-Terminal (BET) Family, ACS Med. Chem. Lett. 2020, 11, 8, 1581 |
Novel Highly Selective Inhibitor of the Second Bromodomains (BD2s) of the Bromodomain and Extra-Terminal (BET) Family