No products
View larger AOB13539
CAS: 2230820-11-6
Chemical Name: AZD-7648; 7-Methyl-2-((7-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino)-9-(tetrahydro-2H-pyran-4-yl)-7,9-dihydro-8H-purin-8-one
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $22.95 | Total: $114.75 |
| 1 | 10 | $19.44 | Total: $194.40 |
| 1 | 25 | $16.47 | Total: $411.75 |
| 1 | 50 | $14.04 | Total: $702.00 |
| 1 | 100 | $12.15 | Total: $1,215.00 |
| Molecular Formula | C18H20N8O2 |
| Molecular Weight | 380.4 |
| CAS Numbers | 2230820-11-6 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | AZD-7648; AZD7648; AZD 7648 |
| IUPAC/Chemical Name | 7,9-dihydro-7-methyl-2-[(7-methyl[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]-9-(tetrahydro-2H-pyran-4-yl)-8H-purin-8-one |
| InChl Key | XISVSTPEXYIKJL-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C18H20N8O2/c1-11-7-15-20-10-21-25(15)9-13(11)22-17-19-8-14-16(23-17)26(18(27)24(14)2)12-3-5-28-6-4-12/h7-10,12H,3-6H2,1-2H3,(H,19,22,23) |
| SMILES Code | CN1C2=CN=C(NC3=CN4C(C=C3C)=NC=N4)N=C2N(C5CCOCC5)C1=O |
| References | 1) Finlay, M., and Verschoyle, R. Amino-triazolopyridine compounds and their use in treating cancer. (2018). |
Novel potent and selective DNA-PK inhibitor