No products
View larger AOB11564
CAS: 2057509-72-3
Chemical Name: AZD-4573; (1S,3R)-3-Acetamido-N-(5-chloro-4-(5,5-dimethyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)pyridin-2-yl)cyclohexanecarboxamide
998 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $50.15 | Total: $250.75 |
| 1 | 10 | $42.48 | Total: $424.80 |
| 1 | 25 | $35.99 | Total: $899.75 |
| 1 | 50 | $30.68 | Total: $1,534.00 |
| 1 | 100 | $26.55 | Total: $2,655.00 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 |
| CAS Numbers | 2057509-72-3 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | AZD4573; AZD-4573; AZD 4573. |
| IUPAC/Chemical Name | (1S,3R)-3-acetamido-N-(5-chloro-4-(5,5-dimethyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)pyridin-2-yl)cyclohexane-1-carboxamide |
| InChl Key | AVIWDYSJSPOOAR-LSDHHAIUSA-N |
| InChl Code | InChI=1S/C22H28ClN5O2/c1-13(29)26-15-6-4-5-14(7-15)21(30)27-20-8-16(18(23)11-24-20)17-10-25-28-12-22(2,3)9-19(17)28/h8,10-11,14-15H,4-7,9,12H2,1-3H3,(H,26,29)(H,24,27,30)/t14-,15+/m0/s1 |
| SMILES Code | ClC1=CN=C(NC([C@H]2CCC[C@@H](NC(C)=O)C2)=O)C=C1C3=C(CC(C)(C)C4)N4N=C3 |
| References | 1) Bing Z Carter et al., Targeting MCL-1 dysregulates cell metabolism and leukemia-stroma interactions and resensitizes acute myeloid leukemia to BCL-2 inhibition, Haematologica 2020 Dec 23;Online ahead of print. doi: 10.3324/haematol.2020.260331. |
Novel Highly Selective CDK9 Inhibitor, Suppressing MCL-1 and Inducing Apoptosis in Hematologic Cancer Cells