No products
View larger AOB2964
CAS 118458-54-1
Chemical Name: 12,13-Dihydro-5H-indolo[2,3-a]pyrrolo[3,4-c]carbazole-5,7(6H)-dione
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C20H11N3O2 |
| Molecular Weight | 325.3 |
| CAS Numbers | 118458-54-1 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMF: 5 mg/ml DMF:PBS(pH7.2) (1:2): 0.33 mg/ml DMSO: 1 mg/ml |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | 12,13-dihydro-5H-indolo[2,3-a]pyrrolo[3,4-c]carbazole-5,7(6H)-dione |
| InChl Key | KAJXOWFGKYKMMZ-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C20H11N3O2/c24-19-15-13-9-5-1-3-7-11(9)21-17(13)18-14(16(15)20(25)23-19)10-6-2-4-8-12(10)22-18/h1-8,21-22H,(H,23,24,25) |
| SMILES Code | O=C1NC(C2=C1C(C3=CC=CC=C3N4)=C4C5=C2C6=C(C=CC=C6)N5)=O |
| References | 1) Sanchez-Martinez, C., Shih, C., Faul, M.M., et al. Aryl[a]pyrrolo[3,4-c]carbazoles as selective cyclin D1-CDK4 inhibitors. Bioorg. Med. Chem. Lett. 13(21), 3835-3839 (2003). 2) Slater, M.J., Cockerill, S., Baxter, R., et al. Indolocarbazoles: Potent, selective inhibitors of human cytomegalovirus replication. Bioorg. Med. Chem. 7(6), 1067-1074 (1999). |
Potent inhibitor of cdk4/cyclin D1 and CaM kinase II