No products
View larger AOB4063
CAS No: 1034297-58-9
Chemical Name: 3-[6-Amino-5-(6-ethoxy-2-naphthalenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]-benzamide
395 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $12.75 | Total: $63.75 |
| 1 | 10 | $10.80 | Total: $108.00 |
| 1 | 25 | $9.15 | Total: $228.75 |
| 1 | 50 | $7.80 | Total: $390.00 |
| 1 | 100 | $6.75 | Total: $675.00 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 454.56 |
| CAS Numbers | 1034297-58-9 |
| Synonym | CRT0066051 |
| IUPAC/Chemical Name | 3-[6-amino-5-(6-ethoxy-2-naphthalenyl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]-benzamide |
| InChl Key | InChI=1S/C28H30N4O2/c1-4-34-25-11-10-20-14-22(9-8-21(20)16-25)26-17-24(18-31-27(26)29)19-6-5-7-23(15-19)28(33)30-12-13-32(2)3/h5-11,14-18H,4,12-13H2,1-3H3,(H2,29,31)(H,30,33) |
| InChl Code | XBDRAUPLGHAFCU-UHFFFAOYSA-N |
| SMILES Code | CCOC1=CC=C2C(C=CC(C3=CC(C4=CC(C(NCCN(C)C)=O)=CC=C4)=CN=C3N)=C2)=C1 |
| References | Evans, I.M., Bagherzadeh, A., Charles, M., et al. Characterization of the biological effects of a novel protein kinase D inhibitor in endothelial cells. Biochemistry Journal 429(3), 565-572 (2010). |
Novel protein kinase D inhibitor