No products
View larger AOB16752
CAS 220749-41-7
Chemical Name: 3-[(2-Chloro-1H-indol-3-yl)methylidene]-1H-indol-2-one
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $17.85 | Total: $89.25 |
| 1 | 10 | $15.12 | Total: $151.20 |
| 1 | 25 | $12.81 | Total: $320.25 |
| 1 | 50 | $10.92 | Total: $546.00 |
| 1 | 100 | $9.45 | Total: $945.00 |
| Molecular Formula | C17H11ClN2O |
| Molecular Weight | 294.74 |
| CAS Numbers | 220749-41-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | 3-[(2-Chloro-1H-indol-3-yl)methylidene]-1H-indol-2-one |
| InChl Key | QJKBRWSJWQVKLY-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C17H11ClN2O/c18-16-12(10-5-1-3-7-14(10)19-16)9-13-11-6-2-4-8-15(11)20-17(13)21/h1-9,19H,(H,20,21) |
| SMILES Code | C1=CC=C2C(=C1)C(=CC3=C(NC4=CC=CC=C43)Cl)C(=O)N2 |
| References | 1) Imidazo[2,1-b]thiazolylmethylene- and indolylmethylene-2-indolinones: A new class of cyclin-dependent kinase inhibitors. Design, synthesis, and CDK1/cyclin B inhibition, Anti-cancer Drug Design 15(6):447-52 (2001). |
Selective CDK1 inhibitor (IC50: CDK1 5.8µM; CDK5 25µM, GSK3β >100µM)