No products
View larger ATP2092L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $147.90 | Total: $739.50 |
| 1 | 10 | $125.28 | Total: $1,252.80 |
| 1 | 25 | $106.14 | Total: $2,653.50 |
| 1 | 50 | $90.48 | Total: $4,524.00 |
| 1 | 100 | $78.30 | Total: $7,830.00 |
| Molecular Formula | C98H160N34O22S |
| Molecular Weight | 2198.63 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | O=C(C)O.O=C(N[C@@H](CC1=CC=CC=C1)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCCNC(N)=N)C(N2[C@@H](CCC2)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC(C)C)C(N[C@@H](CO)C(N[C@@H](CC3=CNC=N3)C(N[C@@H](CCCCN)C(NCC(N4[C@@H](CCC4)C(N[C@@H](CCSC)C(N5[C@@H](CCC5)C(N[C@@H](CC6=CC=CC=C6)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCCCN)N |
| References | Medhurst et al [2003] Pharmacological and immunohistochemical characterization of the APJ receptor and its endogenous ligand apelin. J.Neurochem. 84 1162 PMID |