No products
View larger ATP1970L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $107.10 | Total: $535.50 |
| 1 | 10 | $90.72 | Total: $907.20 |
| 1 | 25 | $76.86 | Total: $1,921.50 |
| 1 | 50 | $65.52 | Total: $3,276.00 |
| 1 | 100 | $56.70 | Total: $5,670.00 |
| Molecular Formula | C71H114N16O28 |
| Molecular Weight | 1639.76 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CC(O)=O.OC1=CC=C(C=C1)C[C@@H](C(O)=O)NC([C@H](CC(C)C)NC([C@H]([C@@H](C)CC)NC([C@H](CCC(O)=O)NC([C@H](CCC(O)=O)NC([C@H]([C@H](O)C)NC([C@H](C)NC([C@H](CC(N)=O)NC([C@H](CC(N)=O)NC([C@H](CC(O)=O)NC([C@H]([C@@H](C)CC)NC([C@H](CC(C)C)NC([C@@H](C)NC([C@H]([C@H](O)C)N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O |
| References | Meyer RC, et al. GPR37 and GPR37L1 are receptors for the neuroprotective and glioprotective factors prosaptide and prosaposin. Proc Natl Acad Sci U S A. 2013;110[23] 9529-9534. |