No products
View larger AT9125
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $76.50 | Total: $382.50 |
| 1 | 10 | $64.80 | Total: $648.00 |
| 1 | 25 | $54.90 | Total: $1,372.50 |
| 1 | 50 | $46.80 | Total: $2,340.00 |
| 1 | 100 | $40.50 | Total: $4,050.00 |
| Molecular Formula | C26H25N5O3 |
| Molecular Weight | 455.51 |
| CAS Numbers | 1971920-73-6 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | Nc1nccc2n([C@@H]3CCCN(C3)C(=O)C=C)c(=O)n(-c3ccc(Oc4ccccc4)cc3)c12 |
| References | Reich DS, et al. Safety and efficacy of tolebrutinib, an oral brain-penetrant BTK inhibitor, in relapsing multiple sclerosis a phase 2b, randomised, double-blind, placebo-controlled trial. Lancet Neurol. 2021 Sep;20[9] 729-738. |