No products
View larger AT4227
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $32.30 | Total: $161.50 |
| 1 | 10 | $27.36 | Total: $273.60 |
| 1 | 25 | $23.18 | Total: $579.50 |
| 1 | 50 | $19.76 | Total: $988.00 |
| 1 | 100 | $17.10 | Total: $1,710.00 |
| Molecular Formula | C23H25ClN4O |
| Molecular Weight | 408.92 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | Cl.CN1CC=CCCOc2cccc(c2)-c2ccnc(Nc3cccc(C1)c3)n2 |
| References | William AD, et al. Discovery of kinase spectrum selective macrocycle [16E]-14-methyl-20-oxa-5,7,14,26-tetraazatetracyclo[19.3.1.1[2,6].1[8,12]]heptacosa-1[25],2[26],3,5,8[27],9,11,16,21,23-decaene [SB1317TG02], a potent inhibitor of cyclin dependent kina |