No products
View larger AOB15540
CAS No:1265789-88-5
Chemical Name: 5-tert-Butyl-2-(1H-indazol-5-ylcarbamoylamino)thiophene-3-carboxylic acid
499 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $65.45 | Total: $327.25 |
| 1 | 10 | $55.44 | Total: $554.40 |
| 1 | 25 | $46.97 | Total: $1,174.25 |
| 1 | 50 | $40.04 | Total: $2,002.00 |
| 1 | 100 | $34.65 | Total: $3,465.00 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.41 |
| CAS Numbers | 1265789-88-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | S6K-18; S6K18; S6K 18 |
| IUPAC/Chemical Name | 2-(3-(1H-indazol-5-yl)ureido)-5-(tert-butyl)thiophene-3-carboxylic acid |
| InChl Key | BSRFCMMJUFQEOX-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C17H18N4O3S/c1-17(2,3)13-7-11(15(22)23)14(25-13)20-16(24)19-10-4-5-12-9(6-10)8-18-21-12/h4-8H,1-3H3,(H,18,21)(H,22,23)(H2,19,20,24) |
| SMILES Code | O=C(C1=C(NC(NC2=CC3=C(NN=C3)C=C2)=O)SC(C(C)(C)C)=C1)O |
| References | 1) Ye, P., Kuhn, C., Juan, M., et al. Potent and selective thiophene urea-templated inhibitors of S6K. Bioorg. Med. Chem. Lett. 21(2), 849-852 (2011). |
A highly selective inhibitor of S6K1