No products
View larger AT8343
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $58.65 | Total: $293.25 |
| 1 | 10 | $49.68 | Total: $496.80 |
| 1 | 25 | $42.09 | Total: $1,052.25 |
| 1 | 50 | $35.88 | Total: $1,794.00 |
| 1 | 100 | $31.05 | Total: $3,105.00 |
| Molecular Formula | C10H13N5O5 |
| Molecular Weight | 283.24 |
| CAS Numbers | 88847-89-6 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | Nc1nc(=O)c2[nH]c(=O)n([C@H]3C[C@H](O)[C@@H](CO)O3)c2[nH]1 |
| References | Szyma?ska B, D?ugosz A. The role of the BLCA-4 nuclear matrix protein in bladder cancer. Postepy Hig Med Dosw [Online]. 2017 Aug 13;71[1] 681-689. Review. |