No products
View larger | Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $157.25 | Total: $786.25 |
| 1 | 10 | $133.20 | Total: $1,332.00 |
| 1 | 25 | $112.85 | Total: $2,821.25 |
| 1 | 50 | $96.20 | Total: $4,810.00 |
| 1 | 100 | $83.25 | Total: $8,325.00 |
| Molecular Formula | C64H101N21O18S |
| Molecular Weight | 1484.68 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CC([C@H](NC([C@H](CCCNC(N)=N)NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC(CNC([C@@H](N)CC1=CC=C(O)C=C1)=O)=O)=O)CC2=CC=CC=C2)=O)CCSC)=O)CCCNC(N)=N)=O)=O)C(NCC(N[C@@H](CCCNC(N)=N)C(N3CCC[C@H]3C(N[C@H](C(O)=O)CCC(O)=O)=O)=O)=O)=O)C.CC(O)=O |
| References | Baird A, et al. Molecular forms of the putative enkephalin precursor BAM-12P in bovine adrenal, pituitary, and hypothalamus. Proc Natl Acad Sci U S A. 1982 Mar;79[6] 2023-5. |