No products
View larger AT67926
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $106.25 | Total: $531.25 |
| 1 | 10 | $90.00 | Total: $900.00 |
| 1 | 25 | $76.25 | Total: $1,906.25 |
| 1 | 50 | $65.00 | Total: $3,250.00 |
| 1 | 100 | $56.25 | Total: $5,625.00 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 |
| CAS Numbers | 790676-40-3 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C(C)[C@@]1(C(=O)N(CC2=CC=CC=C2)C(=O)N1)C3=CC=CC=C3 |
| References | Suzuki H, et al. Active-site characteristics of CYP2C19 and CYP2C9 probed with hydantoin and barbiturate inhibitors. Arch Biochem Biophys. 2004;429[1] 1-15. |