No products
View larger AT37997
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $288.15 | Total: $1,440.75 |
| 1 | 10 | $244.08 | Total: $2,440.80 |
| 1 | 25 | $206.79 | Total: $5,169.75 |
| 1 | 50 | $176.28 | Total: $8,814.00 |
| 1 | 100 | $152.55 | Total: $15,255.00 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.57 |
| CAS Numbers | 668-49-5 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])C[C@@H](O)[C@]2([H])C[C@H](O)CC[C@]12C |
| References | Khallou J, et al. Metabolism and time-course excretion of murideoxycholic acid, a 6 beta-hydroxylated bile acid, in humans. J Hepatol. 1993;17[3] 364-372. |