No products
View larger AT38648L
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $114.75 | Total: $573.75 |
| 1 | 10 | $97.20 | Total: $972.00 |
| 1 | 25 | $82.35 | Total: $2,058.75 |
| 1 | 50 | $70.20 | Total: $3,510.00 |
| 1 | 100 | $60.75 | Total: $6,075.00 |
| Molecular Formula | C149H257N45O45 |
| Molecular Weight | 3398.91 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CC(O)=O.N=C(N)NCCC[C@@H](C(O)=O)NC([C@H]1N(C(CNC(CNC([C@H](CCC(N)=O)NC([C@H]([C@@H](C)CC)NC([C@H](C)NC([C@H]([C@@H](C)CC)NC([C@H](C)NC([C@H]([C@@H](C)CC)NC(CNC([C@H](CCC(O)=O)NC([C@H](CO)NC([C@H]([C@@H](C)CC)NC([C@H](CCCNC(N)=N)NC([C@H](CCCCN)NC([C@H](CCCCN)NC([C@H](C)NC([C@H](CO)NC([C@H](CC(N)=O)NC([C@H](CCC(O)=O)NC([C@H](CC(C)C)NC([C@H](CCCCN)NC([C@H](CCCCN)NC([C@H](C)NC([C@H]([C@H](O)C)NC([C@H](CCCCN)NC([C@H](CO)NC([C@H](CC(C)C)NC([C@H](CC2=CNC3=C2C=CC=C3)NC([C@H](CO)N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)CCC1)=O |
| References | Jayaprakash K, et al. Transthyretin [ttr] irna composition and methods of use thereof for treating or preventing ttr-associated ocular diseases. WO2021092145A1 |