No products
View larger AOB11248
CAS 854503-32-5
Chemical Name: Acridonylalanine; L-2-Acridonylalanine; (S)-2-Amino-3-(9-oxo-9,10-dihydroacridin-2-yl)propanoic acid
100 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $109.65 | Total: $548.25 |
| 1 | 10 | $92.88 | Total: $928.80 |
| 1 | 25 | $78.69 | Total: $1,967.25 |
| 1 | 50 | $67.08 | Total: $3,354.00 |
| 1 | 100 | $58.05 | Total: $5,805.00 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 |
| CAS Numbers | 854503-32-5 |
| Storage Condition | 0C Short Term -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | Acridonylalanine; L-2-Acridonylalanine |
| IUPAC/Chemical Name | (S)-2-Amino-3-(9-oxo-9,10-dihydroacridin-2-yl)propanoic acid |
| InChl Key | NPALYBYZIAGBTE-LBPRGKRZSA-N |
| InChl Code | InChI=1S/C16H14N2O3/c17-12(16(20)21)8-9-5-6-14-11(7-9)15(19)10-3-1-2-4-13(10)18-14/h1-7,12H,8,17H2,(H,18,19)(H,20,21)/t12-/m0/s1 |
| SMILES Code | C1=CC=C2C(=C1)C(=O)C3=C(N2)C=CC(=C3)C[C@@H](C(=O)O)N |
| References | 1 Hiroyuki Hamada et al., BiPosition-specific incorporation of a highly photodurable and blue-laser excitable fluorescent amino acid into proteins for fluorescence sensingoorganic & Medicinal Chemistry Volume 13, Issue 10, 16 May 2005, Pages 3379-3384 |
Highly photodurable and blue-laser excitable fluorescent amino acid. acting as a highly fluorescent probe after being incorporated into specific positions of various antibodies, receptors, and enzymes