No products
View larger CFN99286
CAS: 1187925-30-9
100 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $131.75 | Total: $658.75 |
| 1 | 10 | $111.60 | Total: $1,116.00 |
| 1 | 25 | $94.55 | Total: $2,363.75 |
| 1 | 50 | $80.60 | Total: $4,030.00 |
| 1 | 100 | $69.75 | Total: $6,975.00 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.3 |
| CAS Numbers | 1187925-30-9 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO and Alcohol |
| Purity | 98% by HPLC |
| SMILES Code | C[C@@H]([C@@]1([H])C[C@H](O2)[C@@]2(C)[C@@H](O)C[C@@H](O3)[C@]3(C)C[C@]1([H])O4)C4=O |
Carabrolactone A can be extracted from the rhizomes of Carpesium abrotanoides.