No products
View larger APB0095
CAS: 31271-07-5
499 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $9.35 | Total: $46.75 |
| 1 | 10 | $7.92 | Total: $79.20 |
| 1 | 25 | $6.71 | Total: $167.75 |
| 1 | 50 | $5.72 | Total: $286.00 |
| 1 | 100 | $4.95 | Total: $495.00 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.43 |
| CAS Numbers | 31271-07-5 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| IUPAC/Chemical Name | 9H-Xanthen-9-one, 1,3,6,7-tetrahydroxy-2,8-bis(3-methyl-2-butenyl)- |
| InChl Key | VEZXFTKZUMARDU-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C23H24O6/c1-11(2)5-7-13-15(24)9-18-20(22(13)27)23(28)19-14(8-6-12(3)4)21(26)16(25)10-17(19)29-18/h5-6,9-10,24-27H,7-8H2,1-4H3 |
| SMILES Code | CC(=CCc1c(O)cc2Oc3cc(O)c(O)c(CC=C(C)C)c3C(=O)c2c1O)C |
| References | 1) Li, X. Comparative study of 1,1-diphenyl-2-picryl-hydrazyl radical (DPPH•) scavenging capacity of the antioxidant xanthones family. Chemistry Select 3(46), 13081-13086 (2018). 2) Chi, X.-Q., Zi, C.-T., Li, H.-M., et al. Design, synthesis and structure–activity relationships of mangostin analogs as cytotoxic agents. RSC Adv. 8(72), 41377-41388 (2018). |