No products
View larger AOB1076
CAS: 443292-81-7
Chemical Name: SF-11; N-(4-ethoxyphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide
950 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $22.95 | Total: $114.75 |
| 1 | 10 | $19.44 | Total: $194.40 |
| 1 | 25 | $16.47 | Total: $411.75 |
| 1 | 50 | $14.04 | Total: $702.00 |
| 1 | 100 | $12.15 | Total: $1,215.00 |
| Molecular Formula | C27H30N2O2S |
| Molecular Weight | 446.60 |
| CAS Numbers | 443292-81-7 |
| Storage Condition | 0°C (short term), -20°C (long term), desiccated |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| Synonym | SF-11, SF11, SF 11 |
| IUPAC/Chemical Name | N-(4-ethoxyphenyl)-4-[hydroxy(diphenyl)methyl]piperidine-1-carbothioamide |
| InChl Key | PMEQBGAGFZDWQX-UHFFFAOYSA-N |
| InChl Code | InChI=1S/C27H30N2O2S/c1-2-31-25-15-13-24(14-16-25)28-26(32)29-19-17-23(18-20-29)27(30,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16,23,30H,2,17-20H2,1H3,(H,28,32) |
| SMILES Code | S=C(N1CCC(C(C2=CC=CC=C2)(O)C3=CC=CC=C3)CC1)NC4=CC=C(OCC)C=C4 |
| References | 1) Brothers et al (2010) Selective and brain penetrant neuropeptide Y Y2 receptor antagonists discovered by whole-cell high-throughput screening. Mol.Pharmacol. 77 46 PMID: 19837904 2) Domin et al (2019) Characterization of the brain penetrant neuropeptide Y Y2 receptor antagonist SF-11. ACS Chem.Neurosci. 10 3454 PMID: 31267743 |
Selective NPY-Y2 Receptor Antagonist