No products
View larger | Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $459.85 | Total: $2,299.25 |
| 1 | 10 | $389.52 | Total: $3,895.20 |
| 1 | 25 | $330.01 | Total: $8,250.25 |
| 1 | 50 | $281.32 | Total: $14,066.00 |
| 1 | 100 | $243.45 | Total: $24,345.00 |
| Molecular Formula | C51H65N9O10 |
| Molecular Weight | 964.12 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CCCC[C@@H](C(N)=O)NC([C@H](CCC1)N1C([C@@H](CCC1)N1C([C@H](Cc1ccccc1)NC([C@@H](Cc1c[nH]c2c1cccc2)NC([C@H](C)NC([C@H](C)NC(c1ccccc1)=O)=O)=O)=O)=O)=O)=O.CC(O)=O |
| References | A B McElroy, et al. Highly potent and selective heptapeptide antagonists of the neurokinin NK-2 receptor. J Med Chem. 1992 Jul 10;35[14] 2582-91. |