No products
View larger | Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $107.10 | Total: $535.50 |
| 1 | 10 | $90.72 | Total: $907.20 |
| 1 | 25 | $76.86 | Total: $1,921.50 |
| 1 | 50 | $65.52 | Total: $3,276.00 |
| 1 | 100 | $56.70 | Total: $5,670.00 |
| Molecular Formula | C59H72N14O12 |
| Molecular Weight | 1169.29 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | N=C(N)NCCC[C@@H](C(N)=O)NC([C@@H](CC1=CNC2=C1C=CC=C2)NC([C@@H](CC3=CNC4=C3C=CC=C4)NC([C@H](C(C)C)NC([C@@H](CC5=CNC6=C5C=CC=C6)NC([C@H](CC7=CC=C(O)C=C7)NC([C@H](CC(O)=O)N)=O)=O)=O)=O)=O)=O.CC(O)=O |
| References | Rovero P, Astolfi M, Renzetti AR, Patacchini R, Giachetti A, Maggi CA. Role of D-tryptophan for affinity of MEN 10207 tachykinin antagonist at NK2 receptors. Peptides. 1991 Sep-Oct;12[5] 1015-8. doi 10.10160196-9781[91]90053-r. PMID 1666180. |