No products
View larger ATP1380
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $120.70 | Total: $603.50 |
| 1 | 10 | $102.24 | Total: $1,022.40 |
| 1 | 25 | $86.62 | Total: $2,165.50 |
| 1 | 50 | $73.84 | Total: $3,692.00 |
| 1 | 100 | $63.90 | Total: $6,390.00 |
| Molecular Formula | C78H116N20O21 |
| Molecular Weight | 1669.88 |
| CAS Numbers | 125118-77-6 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | C([C@@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(N[C@@H](CC1=CC=C(O)C=C1)C(N[C@H](C(N[C@H](C(NCC(=O)N2[C@H](C(N[C@@H](CC3=CN=CN3)C(N[C@H](C(N[C@@H]([C@H](CC)C)C(O)=O)=O)C)=O)=O)CCC2)=O)CC(C)C)=O)CC(C)C)=O)=O)=O)C)=O)CO)=O)CC(N)=O)=O)CC(C)C)=O)[C@@H](C)O)=O)NC(CN)=O)C=4C=5C(NC4)=CC=CC5 |
| References | Hilke S, et al. A short estrogen-responsive N-terminal galanin homologue found in rat brain and gut with antiserum raised against rat galanin[1-16]. Neurochem Res. 2006 Feb;31[2] 177-88. |