No products
View larger | Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $141.10 | Total: $705.50 |
| 1 | 10 | $119.52 | Total: $1,195.20 |
| 1 | 25 | $101.26 | Total: $2,531.50 |
| 1 | 50 | $86.32 | Total: $4,316.00 |
| 1 | 100 | $74.70 | Total: $7,470.00 |
| Molecular Formula | C26H20N6 |
| Molecular Weight | 416.48 |
| CAS Numbers | 4402-18-0 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | NC=1C=C(C=2NC=3C(N2)=CC=C(C3)C=4C=C5C(=CC4)N=C(N5)C6=CC(N)=CC=C6)C=CC1 |
| References | D W Jun, et al. Characterization of DDRI-18 [3,3'-[1H,3'H-5,5'-bibenzo[d]imidazole-2,2'-diyl]dianiline], a novel small molecule inhibitor modulating the DNA damage response. Br J Pharmacol. 2012 Sep;167[1] 141-50. |