No products
View larger AT3480
1000 Items
| Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $49.30 | Total: $246.50 |
| 1 | 10 | $41.76 | Total: $417.60 |
| 1 | 25 | $35.38 | Total: $884.50 |
| 1 | 50 | $30.16 | Total: $1,508.00 |
| 1 | 100 | $26.10 | Total: $2,610.00 |
| Molecular Formula | C29H28F3N5O |
| Molecular Weight | 519.56 |
| CAS Numbers | 676266-31-2 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | N(C(=O)C=1C=CN=CC1)N2C(=CC(CN3CCN(CC3)C4=CC(C(F)(F)F)=CC=C4)=C2C)C5=CC=CC=C5 |
| References | Didilescu C, Craiova UM. [Present and future in the use of anti-tubercular drugs]. Pneumologia. 2011 Oct-Dec;60[4] 198-201. |