No products
View larger | Quantity | mg | Unit Price ($/mg or $/Unit) | Final Price |
|---|---|---|---|
| 1 | 5 | $228.65 | Total: $1,143.25 |
| 1 | 10 | $193.68 | Total: $1,936.80 |
| 1 | 25 | $164.09 | Total: $4,102.25 |
| 1 | 50 | $139.88 | Total: $6,994.00 |
| 1 | 100 | $121.05 | Total: $12,105.00 |
| Molecular Formula | C84H142N32O23 |
| Molecular Weight | 1968.23 |
| Storage Condition | 0C Short Term, -20C Long Term |
| Solubility | DMSO |
| Purity | 98% by HPLC |
| SMILES Code | CC(O)=O.O=C(N)[C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC(CNC(CNC(CNCC1=CC=CC=C1)=O)=O)=O)CC2=CC=CC=C2)=O)[C@H](O)C)=O)=O)C)=O)CCCNC(N)=N)=O)CCCCN)=O)CO)=O)C)=O)CCCNC(N)=N)=O)CCCCN)=O)CCCNC(N)=N)=O)CCCCN)=O)CC(N)=O)=O)CCC(N)=O |
| References | Gavioli EC, et al. Blockade of nociceptinorphanin FQ-NOP receptor signalling produces antidepressant-like effects pharmacological and genetic evidences from the mouse forced swimming test. Eur J Neurosci. 2003;17[9] 1987-1990. |